A0998750
1-(Chloromethyl)-3,5-dinitrobenzene , 97% , 74367-78-5
Synonym(s):
α-Chloro-3,5-dinitrotoluene
CAS NO.:74367-78-5
Empirical Formula: C7H5ClN2O4
Molecular Weight: 216.58
MDL number: MFCD00007234
EINECS: 277-841-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB60.00 | In Stock |
|
| 1g | RMB125.60 | In Stock |
|
| 5g | RMB352.00 | In Stock |
|
| 25g | RMB644.80 | In Stock |
|
| 100g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-82 °C (lit.) |
| Boiling point: | 373.4±27.0 °C(Predicted) |
| Density | 1.538±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| Appearance | Light yellow to yellow Solid |
| BRN | 2506587 |
| InChI | 1S/C7H5ClN2O4/c8-4-5-1-6(9(11)12)3-7(2-5)10(13)14/h1-3H,4H2 |
| InChIKey | SMJODKZAFKWUJG-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(CCl)cc(c1)[N+]([O-])=O |
| CAS DataBase Reference | 74367-78-5 |
| EPA Substance Registry System | Benzene, 1-(chloromethyl)-3,5-dinitro- (74367-78-5) |
Description and Uses
3,5-Dinitrobenzyl chloride was used in the synthesis of double-spanned double cavity calix[4]arenes and 3,5-dinitrobenzylamines. It also was used in fluorescence flow immunoassay for determination of 4-nitrophenol.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | CZ0770000 |
| F | 10-19-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |





