A6175712
4-Nitrobenzyl chloroformate , 97% , 4457-32-3
CAS NO.:4457-32-3
Empirical Formula: C8H6ClNO4
Molecular Weight: 215.59
MDL number: MFCD00007375
EINECS: 224-708-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB87.20 | In Stock |
|
| 100G | RMB300.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-34 °C(lit.) |
| Boiling point: | 230°C 10mm |
| Density | 1.4928 (rough estimate) |
| refractive index | 1.552-1.556 |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 912446 |
| Stability: | Stable, but moisture-sensitive. May develop pressure in storage. Incompatible with moisture, strong bases, alcohols, amines, acids. |
| Major Application | peptide synthesis |
| InChI | 1S/C8H6ClNO4/c9-8(11)14-5-6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
| InChIKey | MHSGOABISYIYKP-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(COC(Cl)=O)cc1 |
| CAS DataBase Reference | 4457-32-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbonochloridic acid, (4-nitrophenyl)methyl ester(4457-32-3) |
| EPA Substance Registry System | Carbonochloridic acid, (4-nitrophenyl)methyl ester (4457-32-3) |
Description and Uses
4-Nitrobenzyl Chloroformate is used in the preparation of prodrugs of cytotoxic acridines used in conjunction with enzyme prodrugs which counter carcinoma cells.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,T |
| Risk Statements | 34-37-23/24/25-36/37 |
| Safety Statements | 26-36/37/39-45-38-28A-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 3-4.9 |
| Hazard Note | Corrosive/Toxic/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |








