A6278912
4-Nitrophenyl Chloroformate , >98.0%(T) , 7693-46-1
Synonym(s):
4-Nitrophenyl chlorocarbonate, Chloroformic acid 4-nitrophenyl ester;4-Nitrophenyl chloroformate;Chloroformic acid 4-nitrophenyl ester
CAS NO.:7693-46-1
Empirical Formula: C7H4ClNO4
Molecular Weight: 201.56
MDL number: MFCD00007321
EINECS: 231-706-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-79 °C(lit.) |
| Boiling point: | 159-162 °C19 mm Hg(lit.) |
| Density | 1.5719 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | >110°C |
| storage temp. | 2-8°C |
| solubility | Soluble in acetone, chloroform, acetone, toluene and benzene. |
| form | isopropanol suspension |
| color | White to yellow-beige |
| Water Solubility | decomposes |
| Sensitive | Lachrymatory |
| BRN | 518127 |
| Stability: | Stable. Incompatible with strong bases, acids. Combustible. |
| Major Application | peptide synthesis |
| InChI | 1S/C7H4ClNO4/c8-7(10)13-6-3-1-5(2-4-6)9(11)12/h1-4H |
| InChIKey | NXLNNXIXOYSCMB-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(OC(Cl)=O)cc1 |
| CAS DataBase Reference | 7693-46-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbonochloridic acid, 4-nitrophenyl ester(7693-46-1) |
| EPA Substance Registry System | Carbonochloridic acid, 4-nitrophenyl ester (7693-46-1) |
Description and Uses
4-Nitrophenyl chloroformate, also known as p-nitrophenyl chloroformate, is a coupling agent used in the synthesis of ureas, carbamates, and carbonates. It is also used as a building block in solid-phase peptide synthesis (SPPS) to obtain altered side chain functionalities in peptides.
4-Nitrophenyl chloroformate can be used:
- As a reagent for the activation of amines, alcohols and thiols.
- In the synthesis of 4-substituted phenyl derivatives of 1,2,4-triazolidindiones (urazoles).
- In the solid-phase synthesis of 3-aryl-2,4-quinazolinedione derivatives with potent anti-cancer property.
- In the preparation of poly(oxyethylene) modified dextrans.
- To synthesize a cleavable, heterobifunctional cross-linker for reversible conjugation of amines to thiol-modified DNA.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,T,Xi,F |
| Risk Statements | 34-36/37-23/24/25-41-36/37/38-11-67-36 |
| Safety Statements | 26-36/37/39-45-38-28A-36-16-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19-21 |
| Hazard Note | Toxic/Corrosive/Lachrymator |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159020 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |






