A1014250
Fructose , 99% , 7660-25-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25g | RMB39.20 | In Stock |
|
| 100g | RMB71.20 | In Stock |
|
| 500g | RMB192.80 | In Stock |
|
| 2.5kg | RMB437.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103°C |
| Boiling point: | 232.96°C (rough estimate) |
| Density | 1.6000 |
| refractive index | 1.6170 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| pka | 11.52±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4-,5+,6-/s3 |
| InChIKey | LKDRXBCSQODPBY-ZSYVZJKANA-N |
| SMILES | C([C@]1(OC[C@@H](O)[C@@H](O)[C@@H]1O)O)O |&1:1,4,6,8,r| |
| CAS DataBase Reference | 7660-25-5 |
| NIST Chemistry Reference | Fructose(7660-25-5) |
| CAS Number Unlabeled | 57-48-7 |
Description and Uses
Fructose is a simple ketonic monosaccharide found in many plants, where it is often bonded to glucose to form the disaccharide sucrose.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazardous Substances Data | 7660-25-5(Hazardous Substances Data) |
