A1017450
Poly(N-isopropylacrylamide) , Mn40,000 , 25189-55-3
Synonym(s):
Polyacrylamide;PNIPAM;PNIPAAM;functionalized polyNIPAM;NIPAM polymer
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB239.20 | In Stock |
|
| 1g | RMB829.60 | In Stock |
|
| 5g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96 °C(lit.) |
| Tg | 130 |
| Density | 1.386 g/cm3 |
| storage temp. | -20°C |
| form | powder |
| color | white to off-white |
| InChI | InChI=1S/C6H11NO/c1-4-6(8)7-5(2)3/h4-5H,1H2,2-3H3,(H,7,8) |
| InChIKey | QNILTEGFHQSKFF-UHFFFAOYSA-N |
| SMILES | C(NC(C)C)(=O)C=C |
| EPA Substance Registry System | 2-Propenamide, N-(1-methylethyl)-, homopolymer (25189-55-3) |
Description and Uses
PolyNIPAM is a stimuli-responsive polymer. The low PDI means that the distribution of chain lengths is narrow which will typically lead to better reproducibility. This polymer for development of thermosensitive coated micro/nano materials including thermoresponsive polymeric drug delivery systems. The carboxylic acid functional group can be used to conjugate a variety of biomolecules to the polymer chain.
Safety
| WGK Germany | 1 |
