A1033112
3-Amino-5-hydroxybenzoic acid, HCl , 95% , 14206-69-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB64.80 | In Stock |
|
| 5G | RMB312.00 | In Stock |
|
| 25g | RMB1527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 269-272 °C (decomp) |
| storage temp. | Inert atmosphere,Room Temperature |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C7H7NO3.ClH/c8-5-1-4(7(10)11)2-6(9)3-5;/h1-3,9H,8H2,(H,10,11);1H |
| InChIKey | CXESTILCPSBCGQ-UHFFFAOYSA-N |
| SMILES | C1(C(=O)O)=CC(=CC(N)=C1)O.Cl |
Description and Uses
3-Amino-5-hydroxybenzoic acid, HCl
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 22-26-36/37/39 |
| Hazard Note | Harmful |
| HS Code | 2922290090 |






