A1035512
5-Amino-2,2-difluorobenzodioxole , 98% , 1544-85-0
CAS NO.：1544-85-0
Empirical Formula: C7H5F2NO2
Molecular Weight: 173.12
MDL number: MFCD00190144
EINECS: 639-983-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1G | RMB71.28 | In Stock |
|
| 5G | RMB276.00 | In Stock |
|
| 25g | RMB976.00 | In Stock |
|
| 100g | RMB2240.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 95-97°C 12mm |
| Density | 1.51±0.1 g/cm3(Predicted) |
| refractive index | 1.498 |
| Flash point: | 95-97°C/12mm |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| pka | 4.18±0.40(Predicted) |
| form | clear liquid |
| color | Colorless to Brown |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Light Sensitive |
| BRN | 1343593 |
| InChI | InChI=1S/C7H5F2NO2/c8-7(9)11-5-2-1-4(10)3-6(5)12-7/h1-3H,10H2 |
| InChIKey | CVYQRDKVWVBOFP-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(N)C=C2OC1(F)F |
| CAS DataBase Reference | 1544-85-0(CAS DataBase Reference) |
Description and Uses
5-Amino-2,2-difluoro-1,3-benzodioxole is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H312-H315-H319-H332 |
| Precautionary statements | P261-P280-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | T,Xi |
| Risk Statements | 20/21/22-36/37/38-52-43-36 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2932990090 |
