4-Aminobenzaldehyde , 98% , 556-18-3
CAS NO.:556-18-3
Empirical Formula: C7H7NO
Molecular Weight: 121.14
MDL number: MFCD00038137
EINECS: 209-115-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB100.00 | In Stock |
|
| 5g | RMB393.60 | In Stock |
|
| 25g | RMB1428.80 | In Stock |
|
| 100g | RMB4799.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 77-79°C |
| Boiling point: | 138-139 C |
| Density | 0,868 g/cm |
| refractive index | 1.5323 (estimate) |
| storage temp. | 2-8°C |
| pka | 1.88±0.10(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| InChI | InChI=1S/C7H7NO/c8-7-3-1-6(5-9)2-4-7/h1-5H,8H2 |
| InChIKey | VATYWCRQDJIRAI-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(N)C=C1 |
| CAS DataBase Reference | 556-18-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 4-amino- (556-18-3) |
Description and Uses
4-Aminobenzaldehyde can be made into polymer with a certain conductivity and corrosion resistance, and the combination of stainless steel is better than the epoxy resin. It can be used as intermediate of pharmaceutical and dye. It is also used in organic synthesis. Additionally, it can react with Carbonyl dichloride to get 4-Formylphenyl isocyanate.
4-Aminobenzaldehyde (p-aminobenzaldehyde) is a useful synthetic reagent and monomer that can be used to synthesize monoazo dyes and photocurable ion exchange resins. 4-Aminobenzaldehyde is also a corrosion inhibitor of metals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-43-22 |
| Safety Statements | 26-36/37/39-36-36/37 |
| RIDADR | UN 1307 |
| WGK Germany | 3 |
| RTECS | CU4400000 |






