A7976012
Terephthalaldehyde Mono(diethyl Acetal) , >97.0%(GC) , 81172-89-6
Synonym(s):
Terephthalaldehyde diethyl acetal
| Pack Size | Price | Stock | Quantity |
| 1g | RMB38.40 | In Stock |
|
| 5g | RMB191.20 | In Stock |
|
| 25G | RMB751.20 | In Stock |
|
| 100g | RMB2463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 89-93 °C (7 mmHg) |
| Density | 1.047 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | liquid (clear) |
| color | clear deep yellow |
| Water Solubility | soluble in alcohol, chlorinated solvents and toluene. Decomposes in water. |
| Sensitive | Air Sensitive |
| BRN | 4293872 |
| InChI | InChI=1S/C12H16O3/c1-3-14-12(15-4-2)11-7-5-10(9-13)6-8-11/h5-9,12H,3-4H2,1-2H3 |
| InChIKey | HTMXMFARWHNJDW-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(C(OCC)OCC)C=C1 |
| CAS DataBase Reference | 81172-89-6(CAS DataBase Reference) |
Description and Uses
4-(Diethoxymethyl)benzaldehyde was used in the synthesis of 4-(diethoxymethyl)benzyl alcohol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| F | 1-10 |
| Hazard Note | Irritant |
| HS Code | 29124900 |
| Storage Class | 10 - Combustible liquids |





