PRODUCT Properties
| Melting point: | 8.72°C (estimate) |
| Boiling point: | 165.27°C (rough estimate) |
| Density | 0.9132 (estimate) |
| refractive index | 1.4534 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Dichloromethane, DMSO |
| form | Oil |
| pka | 15.00±0.10(Predicted) |
| color | Clear Colorless |
| InChI | InChI=1S/C4H11NO/c1-4(5)2-3-6/h4,6H,2-3,5H2,1H3 |
| InChIKey | AGMZSYQMSHMXLT-UHFFFAOYSA-N |
| SMILES | C(O)CC(N)C |
Description and Uses
(R)-3-Aminobutan-1-ol, can be used as an intermediate in the preparation of compounds having HIV integrase inhibitory activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| RIDADR | UN2735 |
| HazardClass | IRRITANT |
| HS Code | 2922190090 |
| REACH Registrations | Active |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







