A1064750
2-tert-Butyl-4-hydroxyanisole , 97% , 88-32-4
Synonym(s):
2-tert-Butyl-4-hydroxyanisole;2-BHA;3-(1,1-Dimethylethyl)-4-methoxyphenol;3-tert-Butyl-4-methoxyphenol
CAS NO.：88-32-4
Empirical Formula: C11H16O2
Molecular Weight: 180.24
MDL number: MFCD00057667
EINECS: 201-820-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB89.60 | In Stock |
|
| 500mg | RMB271.20 | In Stock |
|
| 1g | RMB363.20 | In Stock |
|
| 5g | RMB1276.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64℃ |
| Boiling point: | 253.08°C (rough estimate) |
| Density | 0.9976 (rough estimate) |
| refractive index | 1.4708 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.58±0.18(Predicted) |
| color | Off-White to Pale Beige |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C11H16O2/c1-11(2,3)9-7-8(12)5-6-10(9)13-4/h5-7,12H,1-4H3 |
| InChIKey | IMOYOUMVYICGCA-UHFFFAOYSA-N |
| SMILES | O(C)c1c(cc(cc1)O)C(C)(C)C |
| EPA Substance Registry System | Phenol, 3-(1,1-dimethylethyl)-4-methoxy- (88-32-4) |
Description and Uses
Labelled Phencyclidine analog as anticholinergic agent.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2909500000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |
