A1083012
                    Alitame , 95% , 80863-62-3
                            Synonym(s):
L -α-Aspartyl-N-(2,2,4,4-tetramethyl-3-thietanyl)-D -alaninamide hemi(pentahydrate)
                            
                        
                CAS NO.:80863-62-3
Empirical Formula: C14H25N3O4S
Molecular Weight: 331.43
MDL number: MFCD00868124
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity | 
| 250mg | RMB559.20 | In Stock | 
                                                 | 
                                        
| 1G | RMB1599.20 | In Stock | 
                                                 | 
                                        
| 5G | RMB5599.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 136-147° | 
                                    
| alpha | D25 +40 to +50° (c = 1 in water) | 
                                    
| Boiling point: | 608.5±55.0 °C(Predicted) | 
                                    
| Density | 1.25±0.1 g/cm3(Predicted) | 
                                    
| solubility | Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| pka | 3.71±0.10(Predicted) | 
                                    
| color | White to Off-White | 
                                    
| Odor | odorless | 
                                    
| Odor Type | odorless | 
                                    
| InChI | InChI=1/C14H25N3O4S/c1-7(16-11(21)8(15)6-9(18)19)10(20)17-12-13(2,3)22-14(12,4)5/h7-8,12H,6,15H2,1-5H3,(H,16,21)(H,17,20)(H,18,19)/t7-,8+/s3 | 
                                    
| InChIKey | IVBOUFAWPCPFTQ-WWXSATIUNA-N | 
                                    
| SMILES | N(C1C(C)(C)SC1(C)C)C(=O)[C@@H](C)NC(=O)[C@@H](N)CC(=O)O |&1:11,16,r| | 
                                    
| LogP | 1.508 (est) | 
                                    
| CAS DataBase Reference | 80863-62-3 | 
                                    
Description and Uses
Non-nutritive sweetener.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302 | 
| Precautionary statements | P301+P312+P330 | 
| HS Code | 29400090 | 





