A1083012
Alitame , 95% , 80863-62-3
Synonym(s):
L -α-Aspartyl-N-(2,2,4,4-tetramethyl-3-thietanyl)-D -alaninamide hemi(pentahydrate)
CAS NO.:80863-62-3
Empirical Formula: C14H25N3O4S
Molecular Weight: 331.43
MDL number: MFCD00868124
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB559.20 | In Stock |
|
| 1G | RMB1599.20 | In Stock |
|
| 5G | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-147° |
| alpha | D25 +40 to +50° (c = 1 in water) |
| Boiling point: | 608.5±55.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| solubility | Methanol (Slightly) |
| pka | 3.71±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Odor | odorless |
| Odor Type | odorless |
| InChI | InChI=1/C14H25N3O4S/c1-7(16-11(21)8(15)6-9(18)19)10(20)17-12-13(2,3)22-14(12,4)5/h7-8,12H,6,15H2,1-5H3,(H,16,21)(H,17,20)(H,18,19)/t7-,8+/s3 |
| InChIKey | IVBOUFAWPCPFTQ-WWXSATIUNA-N |
| SMILES | N(C1C(C)(C)SC1(C)C)C(=O)[C@@H](C)NC(=O)[C@@H](N)CC(=O)O |&1:11,16,r| |
| LogP | 1.508 (est) |
| CAS DataBase Reference | 80863-62-3 |
Description and Uses
Alitame is a dipeptide amide derivative of aspartic acid used as an artificial sweetener. Alitame is about ten times sweeter than Aspartame (A790015) with a half life about twice as long.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| HS Code | 29400090 |





