PRODUCT Properties
| Melting point: | 235℃ |
| Boiling point: | 389℃ |
| Density | 1.230 |
| Flash point: | 189℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 0.82±0.25(Predicted) |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C7H7NO2/c1-5-4-8-3-2-6(5)7(9)10/h2-4H,1H3,(H,9,10) |
| InChIKey | OSMAGAVKVRGYGR-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C(O)=O)=C1C |
| CAS DataBase Reference | 4021-12-9(CAS DataBase Reference) |
Description and Uses
An Isonicotinic Acid (I821760) derivative. Used in the preparation of 4,5-dihydro-1H-pyrazole derivatives as cholesterol 24 hydroxylase inhibitors for prevention and/or treatment of neurodegenerative disease.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
