A1100812
ALPHA-BROMOSTYRENE , 95%,stabilized , 98-81-7
CAS NO.:98-81-7
Empirical Formula: C8H7Br
Molecular Weight: 183.05
MDL number: MFCD00012229
EINECS: 202-702-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB158.40 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100G | RMB2352.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −44 °C(lit.) |
| Boiling point: | 67-70 °C4 mm Hg(lit.) |
| Density | 1.41 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 188 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Liquid |
| color | Clear colorless to yellow |
| InChI | InChI=1S/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
| InChIKey | SRXJYTZCORKVNA-UHFFFAOYSA-N |
| SMILES | C1(C(Br)=C)=CC=CC=C1 |
Description and Uses
alpha-Bromostyrene has been suggested as a modifier for the classic chemical omega-Bromostyrol, but does not seem to offer significant advantages. alpha-Bromostyrol is easily hydrolyzed in the presence of water or mild acid to Aceto-phenone (which will affect the odor type significantly).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | WL3840000 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






