A1116112
2-(4-(Aminomethyl)phenoxy)-N,N-dimethylethanamine , 97% , 20059-73-8
CAS NO.:20059-73-8
Empirical Formula: C11H18N2O
Molecular Weight: 194.27
MDL number: MFCD01075231
EINECS: 243-491-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB74.40 | In Stock |
|
| 1G | RMB214.40 | In Stock |
|
| 5g | RMB668.00 | In Stock |
|
| 25g | RMB1831.20 | In Stock |
|
| 100g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120-123 °C(Press: 0.3 Torr) |
| Density | 1.021±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 9.29±0.10(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C11H18N2O/c1-13(2)7-8-14-11-5-3-10(9-12)4-6-11/h3-6H,7-9,12H2,1-2H3 |
| InChIKey | OBHPRQNPNGQGCK-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(OCCN(C)C)C=C1 |
| LogP | 0.860 (est) |
| CAS DataBase Reference | 20059-73-8(CAS DataBase Reference) |
Description and Uses
4-[2-(Dimethylamino)ethoxy]benzylamine is an impurity of Itopride (HCl: I931500), a gastroprokinetic benzamide derivative that is used to treat patients with dyspepsia.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2921490090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B |







