A3386012
3,4-Dimethoxybenzoyl Chloride , ≥98.0%(GC) , 3535-37-3
Synonym(s):
Veratroyl chloride
CAS NO.：3535-37-3
Empirical Formula: C9H9ClO3
Molecular Weight: 200.62
MDL number: MFCD00000674
EINECS: 222-568-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB61.60 | In Stock |
|
| 5G | RMB157.60 | In Stock |
|
| 25G | RMB595.20 | In Stock |
|
| 100G | RMB2055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-73 °C (lit.) |
| Boiling point: | 95-98°C 1mm |
| Density | 1.2799 (rough estimate) |
| refractive index | 1.5230 (estimate) |
| Flash point: | 95-98°C/1mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | Crystals, Flakes or Chunks |
| color | Off-white to gray |
| Sensitive | Moisture Sensitive |
| BRN | 783596 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C9H9ClO3/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5H,1-2H3 |
| InChIKey | VIOBGCWEHLRBEP-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 3535-37-3(CAS DataBase Reference) |
Description and Uses
3,4-Dimethoxybenzoyl chloride has been used in synthesis of:
- (+)-5-(3,4-dimethoxyphenyl)-4-[[N-[(4S)-2-oxo-4-(phenylmethyl)-2-oxazolidinyl]]carbonyl] oxazole and its enantiomer
- N-(2,5-dibromophenyl)-3,4-dimethoxybenzamide
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29222990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
