A1123212
Antioxidant 245 , 98% , 36443-68-2
CAS NO.:36443-68-2
Empirical Formula: C34H50O8
Molecular Weight: 586.77
MDL number: MFCD00134694
EINECS: 253-039-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5g | RMB39.20 | In Stock |
|
| 25g | RMB55.20 | In Stock |
|
| 100g | RMB79.20 | In Stock |
|
| 500g | RMB295.20 | In Stock |
|
| 2.5kg | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-81oC |
| Boiling point: | 602.88°C (rough estimate) |
| Density | 1.0397 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | >150 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.44±0.25(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 104μg/L at 23℃ |
| InChIKey | QSRJVOOOWGXUDY-UHFFFAOYSA-N |
| SMILES | C(C1C=C(C)C(O)=C(C(C)(C)C)C=1)CC(=O)OCCOCCOCCOC(=O)CCC1C=C(C)C(O)=C(C(C)(C)C)C=1 |
| LogP | 4.7 at 23℃ |
| CAS DataBase Reference | 36443-68-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenepropanoic acid, 3-(1,1-dimethylethyl)-4-hydroxy-5-methyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester (36443-68-2) |
Description and Uses
Triethylene Glycol Bis(3-?tert-?butyl-?4-?hydroxy-?5-?methylphenyl)?propionate is used as a polymer antioxidant stabilizer in adhesives and polymers for food contact. Generally functions as an antioxidant in the chemistry of plastics.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410-H413 |
| Precautionary statements | P273-P391-P501 |
| Risk Statements | 52/53 |
| Safety Statements | 61 |







