A1166550
N,N'-Bis(acryloyl)cystamine , 98% , 60984-57-8
Synonym(s):
2,2′-(Bisacrylamino)diethyl disulfide;BAC;Bis(2-acrylamidoethyl) disulfide
CAS NO.:60984-57-8
Empirical Formula: C10H16N2O2S2
Molecular Weight: 260.38
MDL number: MFCD00036225
EINECS: 262-546-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB79.20 | In Stock |
|
| 1g | RMB207.20 | In Stock |
|
| 5g | RMB783.20 | In Stock |
|
| 25g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-125 °C |
| Boiling point: | 538.0±50.0 °C(Predicted) |
| Density | 1.164±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | acetic acid: 50 mg/mL |
| form | Powder, Packaged under argon |
| pka | 13.98±0.46(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in acetic acid. Slightly soluble in water. |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C10H16N2O2S2/c1-3-9(13)11-5-7-15-16-8-6-12-10(14)4-2/h3-4H,1-2,5-8H2,(H,11,13)(H,12,14) |
| InChIKey | DJVKJGIZQFBFGS-UHFFFAOYSA-N |
| SMILES | S(CCNC(=O)C=C)SCCNC(=O)C=C |
| CAS DataBase Reference | 60984-57-8(CAS DataBase Reference) |
Description and Uses
N,N'-Bis(acryloyl)cystamine is used as a reversible cross-linker for polyacrylamide gels. It is also used for DNA purification. Further, it finds application in Suzuki reaction and fabrication of hydrogel modified plasmonic crystal.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |






