A1172850
N-ButylscopolammoniumBromide , 98% , 149-64-4
Synonym(s):
(−)-N-Butylscopolamine bromide;(−)-Scopolamine N-butyl bromide;Hyoscine N-butyl bromide
CAS NO.:149-64-4
Empirical Formula: C21H30BrNO4
Molecular Weight: 440.37
MDL number: MFCD00078561
EINECS: 205-744-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB279.20 | In Stock |
|
| 5g | RMB703.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-1440C |
| alpha | D20 -20.8° (c = 3 in water) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | white |
| optical activity | [α]25/D 20.8°, c = 3 in H2O(lit.) |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChIKey | HOZOZZFCZRXYEK-YNXDNFBCNA-M |
| SMILES | [C@]12([H])O[C@@]1([H])[C@@]1([H])[N+](C)(CCCC)[C@]2([H])C[C@@H](OC(=O)[C@H](CO)C2C=CC=CC=2)C1.[Br-] |&1:0,3,5,13,16,20,r| |
| CAS DataBase Reference | 149-64-4(CAS DataBase Reference) |
Description and Uses
(?)-Scopolamine N-butyl bromide was used as standard in designing a procedure for quantification of compounds using CE-MS.8
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332 |
| Precautionary statements | P261-P264-P270-P271-P301+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | YM3500000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| Toxicity | LD50 in mice (mg/kg): 15.6 i.v.; 74 i.p.; 570 s.c.; 3000 orally (Stockhaus, Wick) |





