PRODUCT Properties
| Melting point: | -14°C |
| Boiling point: | 133-134 °C14 mm Hg(lit.) |
| Density | 0.945 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 4.91±0.10(Predicted) |
| color | Clear yellow to slightly brown |
| Sensitive | Air Sensitive |
| BRN | 1447268 |
| InChI | InChI=1S/C10H15N/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4,11H2,1H3 |
| InChIKey | OGIQUQKNJJTLSZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(CCCC)C=C1 |
| CAS DataBase Reference | 104-13-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-butyl-(104-13-2) |
| EPA Substance Registry System | p-Butylaniline (104-13-2) |
Description and Uses
4-Butylaniline is used in the fabrication of RP/ion-exchange, mixed-mode, monolithic materials for capillary LC.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335-H412 |
| Precautionary statements | P273-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BW9470000 |
| TSCA | TSCA listed |
| HS Code | 29214980 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LD50,intraperitoneal,81mg/kg (81mg/kg),Journal of Medicinal Chemistry. Vol. 17, Pg. 900, 1974. |




