A1181312
Boc-Gln-OH , 98% , 13726-85-7
CAS NO.:13726-85-7
Empirical Formula: C10H18N2O5
Molecular Weight: 246.26
MDL number: MFCD00065571
EINECS: 237-296-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB61.60 | In Stock |
|
| 100G | RMB236.80 | In Stock |
|
| 500g | RMB1189.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-116 °C (dec.)(lit.) |
| Boiling point: | 389.26°C (rough estimate) |
| alpha | -3.5 º (c=2,C2H5OH) |
| Density | 1.2430 (rough estimate) |
| refractive index | -4 ° (C=2, EtOH) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in DMSO and methanol. Soluble in 1 mmole in 2 ml DMF. |
| pka | 3.84±0.10(Predicted) |
| form | Solid |
| color | White |
| optical activity | [α]20/D 3.5°, c = 1 in ethanol |
| BRN | 2127805 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H18N2O5/c1-10(2,3)17-9(16)12-6(8(14)15)4-5-7(11)13/h6H,4-5H2,1-3H3,(H2,11,13)(H,12,16)(H,14,15)/t6-/m0/s1 |
| InChIKey | VVNYDCGZZSTUBC-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](CCC(N)=O)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 13726-85-7(CAS DataBase Reference) |
| EPA Substance Registry System | L-Glutamine, N2-[(1,1-dimethylethoxy)carbonyl]- (13726-85-7) |
Description and Uses
It is employed in the synthesis and analgesic activity of human .beta.-endorphin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |






