A1183712
Benzene-d6 , D,99.96%(0.03%v/vTMS) , 1076-43-3
Synonym(s):
Benzene-D6;Hexadeuterobenzene
CAS NO.:1076-43-3
Empirical Formula: C6D6
Molecular Weight: 84.15
MDL number: MFCD00003010
EINECS: 214-061-8
| Pack Size | Price | Stock | Quantity |
| 2×0.75ml | RMB439.20 | In Stock |
|
| 10×0.75ml | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 6.8 °C(lit.) |
| Melting point: | 5,5°C |
| Boiling point: | 80,1°C |
| Boiling point: | 79.1 °C(lit.) |
| Density | 0.950 g/mL at 25 °C(lit.) |
| Density | d = 0,95 |
| vapor pressure | 101 hPa (20 °C) |
| refractive index | n |
| Flash point: | 12 °F |
| storage temp. | no restrictions. |
| solubility | Miscible with most organic solvents. |
| form | Liquid |
| Specific Gravity | 0.950 |
| color | Colorless |
| explosive limit | 1.4-8.0%(V) |
| Water Solubility | Slightly Soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 1905426 |
| Exposure limits | ACGIH: TWA 0.5 ppm; STEL 2.5 ppm (Skin) OSHA: Ceiling 25 ppm; TWA 10 ppm; TWA 1 ppm; STEL 5 ppm NIOSH: IDLH 500 ppm; TWA 0.1 ppm; STEL 1 ppm |
| Stability: | Stable. Incompatible with oxidizing agents, acids, bases, halogens, metal salts. Protect from moisture. Highly flammable. |
| InChI | 1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1D,2D,3D,4D,5D,6D |
| InChIKey | UHOVQNZJYSORNB-MZWXYZOWSA-N |
| SMILES | [2H]c1c([2H])c([2H])c([2H])c([2H])c1[2H] |
| CAS DataBase Reference | 1076-43-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene-d6 (1076-43-3) |
Description and Uses
Isotope labelled benzene, an organic compound that is a natural constituent of crude oil and one of the most basic petrochemicals.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H319-H340-H350-H372-H412 |
| Precautionary statements | P210-P273-P301+P310-P303+P361+P353-P305+P351+P338-P331 |
| target organs | Blood |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,T |
| Risk Statements | 45-46-11-36/38-48/23/24/25-65-39/23/24/25-23/24/25-48/23/24 |
| Safety Statements | 53-45-36/37 |
| RIDADR | UN 1114 3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Autoignition Temperature | 555 °C |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29022000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Carc. 1A Eye Irrit. 2 Flam. Liq. 2 Muta. 1B Skin Irrit. 2 STOT RE 1 |
| Toxicity | LD50 orally in Rabbit: 930 mg/kg LD50 dermal Rabbit > 8260 mg/kg |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





