A1185412
1,2-Bis(diphenylphosphino)ethane , 98% , 1663-45-2
Synonym(s):
1,2-Bis(diphenylphosphino)ethane;Diphos;dppe
CAS NO.:1663-45-2
Empirical Formula: C26H24P2
Molecular Weight: 398.42
MDL number: MFCD00003047
EINECS: 216-769-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB208.80 | In Stock |
|
| 500G | RMB988.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-142 °C (lit.) |
| Boiling point: | 514.8±33.0 °C(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in acetone, methanol and alcoholic hydrochloric acid. |
| form | Crystalline Powder or Crystals |
| color | White to off-white |
| Sensitive | Air Sensitive |
| BRN | 761261 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. May be air-sensitive. |
| InChI | InChI=1S/C26H24P2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H,21-22H2 |
| InChIKey | QFMZQPDHXULLKC-UHFFFAOYSA-N |
| SMILES | C1C=CC=CC=1P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 1663-45-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Phosphine, 1,2-ethanediylbis[diphenyl-(1663-45-2) |
| EPA Substance Registry System | Phosphine, 1,2-ethanediylbis[diphenyl- (1663-45-2) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335 |
| Precautionary statements | P261-P271-P304+P340+P312-P403+P233-P405-P501 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| F | 9 |
| TSCA | TSCA listed |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | STOT SE 3 |






