1,3-Bis(diphenylphosphino)propane , 97% , 6737-42-4
Synonym(s):
dppp
CAS NO.:6737-42-4
Empirical Formula: C27H26P2
Molecular Weight: 412.45
MDL number: MFCD00003050
EINECS: 229-791-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB56.80 | In Stock |
|
| 100G | RMB186.40 | In Stock |
|
| 500g | RMB758.40 | In Stock |
|
| 1kg | RMB1439.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 63-65 °C (lit.) |
| Boiling point: | 529.7±33.0 °C(Predicted) |
| Flash point: | 235°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Granules or Powder |
| color | White to light yellow-beige |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| BRN | 2821785 |
| InChI | InChI=1S/C27H26P2/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21H,13,22-23H2 |
| InChIKey | LVEYOSJUKRVCCF-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)CCCP(C1C=CC=CC=1)C1C=CC=CC=1 |
| CAS DataBase Reference | 6737-42-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Bis(diphenylphosphino)propane(6737-42-4) |
| EPA Substance Registry System | Phosphine, 1,3-propanediylbis[diphenyl- (6737-42-4) |
Description and Uses
1,3-Bis(diphenylphosphino)propane is a ligand for metal-catalyzed substitution reactions of aryl and vinyl triflates, halides, and carbonates; carbonylation reactions; Grignard coupling; diene alkylation; macrocycle synthesis.
1,3-Bis(diphenylphosphino)propane is used as a bidentate ligand in coordination chemistry and form complex dichloro(1,3-bis(diphenylphosphino)propane)nickel by reacting with nickel(II) chloride. This complex is used as a catalyst for Kumada coupling reaction. It also acts as a ligand for palladium(II) catalysts which is useful for the co-polymerization of carbon monoxide and ethylene to get polyketones. Further, it is employed in palladium-catalyzed arylation under Heck reaction and Suzuki reaction. In addition to this, it serves as a catalyst for Negishi coupling and Sonogashira coupling reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






