Cefoxitin , 98% , 35607-66-0
CAS NO.:35607-66-0
Empirical Formula: C16H17N3O7S2
Molecular Weight: 427.45
MDL number: MFCD00072014
EINECS: 252-641-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB79.20 | In Stock |
|
| 1g | RMB424.80 | In Stock |
|
| 25g | RMB439.20 | In Stock |
|
| 5g | RMB736.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 149-150℃ |
| Boiling point: | 843℃ |
| Density | 1.4441 (rough estimate) |
| refractive index | 1.6390 (estimate) |
| RTECS | XI0386500 |
| Flash point: | >110°(230°F) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.2(at 25℃) |
| color | White to Off-White |
| Water Solubility | Predicted solubility in water is less than 0.2mg/ml |
| InChIKey | WZOZEZRFJCJXNZ-ZBFHGGJFSA-N |
| SMILES | N12[C@@]([H])([C@](OC)(NC(CC3SC=CC=3)=O)C1=O)SCC(COC(N)=O)=C2C(O)=O |
| CAS DataBase Reference | 35607-66-0(CAS DataBase Reference) |
| EPA Substance Registry System | Cefoxitin (35607-66-0) |
Description and Uses
Cefoxitin contains the same C-7 side chain as cephalothin and the same C-3 side chain as cefuroxime. The most novel chemical feature of cefoxitin is the possession of an α-oriented methoxyl group in place of the normal H-atom at C-7. This increased steric bulk conveys very significant stability against β-lactamases. The inspiration for these functional groups was provided by the discovery of the naturally occurring antibiotic cephamycin C derived from fermentation of Streptomyces lactamdurans. Cephamycin C itself has not seen clinical use but, rather, has provided the structural clue that led to useful agents such as cefoxitin. Agents that contain this 7α methoxy group are commonly referred to as cephamycins. Ingenious chemical transformations now enable synthetic introduction of such a methoxy group into cephalosporins lacking this feature.
Antibacterial.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P280g-P302+P352a-P321-P333+P313-P501a |
| RIDADR | 3077 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 30032013 |





