A7053358
CefoxitinSodiumSalt , 10mMinDMSO , 33564-30-6
Synonym(s):
Cefoxitin sodium salt
CAS NO.:33564-30-6
Empirical Formula: C16H18N3NaO7S2
Molecular Weight: 451.44
MDL number: MFCD00079042
EINECS: 251-574-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >160°C |
| Boiling point: | 843℃ |
| alpha | 25589nm +210° (c = 1 in methanol) |
| Flash point: | >110°(230°F) |
| storage temp. | 2-8°C |
| solubility | Very soluble in water, sparingly soluble in alcohol. |
| form | Solid |
| color | White |
| Water Solubility | Soluble in water or methanol |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | GNWUOVJNSFPWDD-XMZRARIVSA-M |
| SMILES | N([C@@]1(C(=O)N2C(=C(COC(=O)N)CS[C@]12[H])C(=O)O)OC)C(=O)CC1SC=CC=1.[NaH] |&1:1,14,r| |
| CAS DataBase Reference | 33564-30-6(CAS DataBase Reference) |
Description and Uses
Cefoxitin is a second generation cephalosporin antibiotic that has been used to treat a wide range of gram-
A broad spectrum antibiotic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280-P302+P352 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-42/43 |
| Safety Statements | 22-26-36/37-36/37/39 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | XI0330500 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29419000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1B |
| Toxicity | LD50 in mice, rats, dogs (g/kg): 5.10, 8.98, >10.0 i.v. (Takayama) |





