A1191612
Boc-Phe(2-Me)-OH , 98% , 114873-05-1
Synonym(s):
Boc-2-methyl-L -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB136.08 | In Stock |
|
| 5G | RMB387.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113°C |
| alpha | -16 º (c=1,MeOH) |
| Boiling point: | 442.5±40.0 °C(Predicted) |
| Density | 1.140±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 3.92±0.11(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | -15°(C=0.01 g/ml, MEOH, 20°C, 589nm) |
| BRN | 5381790 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO4/c1-10-7-5-6-8-11(10)9-12(13(17)18)16-14(19)20-15(2,3)4/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | PCGOCPOJLMLJAR-LBPRGKRZSA-N |
| SMILES | Cc1ccccc1C[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 114873-05-1(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |






