A1191712
N-Boc-2-methyl-D-phenylalanine , 98% , 80102-29-0
Synonym(s):
Boc-2-methyl-D -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB32.00 | In Stock |
|
| 1G | RMB129.60 | In Stock |
|
| 5G | RMB400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116°C |
| Boiling point: | 442.5±40.0 °C(Predicted) |
| alpha | 16 º (c=1,MeOH) |
| Density | 1.140±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.92±0.11(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO4/c1-10-7-5-6-8-11(10)9-12(13(17)18)16-14(19)20-15(2,3)4/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/t12-/m1/s1 |
| InChIKey | PCGOCPOJLMLJAR-GFCCVEGCSA-N |
| SMILES | Cc1ccccc1C[C@@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 80102-29-0(CAS DataBase Reference) |
Description and Uses
peptide synthesis
