A1225512
Boc-L-phenylalanine , ≥98% , 13734-34-4
Synonym(s):
N-(tert-Butoxycarbonyl)-L -phenylalanine;Boc-L -phenylalanine;Boc-Phe-OH;N-α-t.-Boc-L-phenylalanine
CAS NO.:13734-34-4
Empirical Formula: C14H19NO4
Molecular Weight: 265.3
MDL number: MFCD00002663
EINECS: 237-305-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB94.40 | In Stock |
|
| 250g | RMB231.20 | In Stock |
|
| 500G | RMB431.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C(lit.) |
| Boiling point: | 408.52°C (rough estimate) |
| Density | 1.1356 (rough estimate) |
| refractive index | 24.5 ° (C=1, EtOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol, dichloromethane, dimethylformamide and N-methyl-2-pyrrolidone. |
| form | Fine Crystalline Powder |
| pka | 3.88±0.10(Predicted) |
| color | White |
| optical activity | [α]20/D +25±1°, c = 1% in ethanol |
| BRN | 2219729 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C14H19NO4/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/t11-/m0/s1 |
| InChIKey | ZYJPUMXJBDHSIF-NSHDSACASA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 13734-34-4(CAS DataBase Reference) |
| EPA Substance Registry System | L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]- (13734-34-4) |
Description and Uses
N-Boc-L-phenylalanine is a derivative of Phenylalanine used in enantioselective hydrolysis of amino acid esters.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36-22-36/37/38-20/21/22 |
| Safety Statements | 39-26-36-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







