A7531912
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid , 97% , 45214-91-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB27.20 | In Stock |
|
| 5g | RMB42.40 | In Stock |
|
| 25g | RMB135.20 | In Stock |
|
| 100g | RMB477.60 | In Stock |
|
| 500g | RMB1434.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-77 °C |
| Boiling point: | 428.4±40.0 °C(Predicted) |
| Density | 1.182±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 3.82±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C11H19NO6/c1-11(2,3)18-10(16)12-7(9(14)15)5-6-8(13)17-4/h7H,5-6H2,1-4H3,(H,12,16)(H,14,15)/t7-/m0/s1 |
| InChIKey | OHYMUFVCRVPMEY-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@H](CCC(OC)=O)NC(OC(C)(C)C)=O |
Description and Uses
N-Boc-L-glutamic Acid 5-Methyl Ester is an intermediate used in the synthesis of Isodesmosine Chloride Hydrate (Synthetic) (I815051), which is a component of elastin and also it is extremely hygroscopic and must be stored over a desiccant such as silica gel.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H332-H335-H334 |
| Precautionary statements | P261-P264-P270-P271-P280-P285-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P342+P311-P362-P403+P233-P405-P501 |
| HS Code | 2924190090 |
