A5511412
Methyl Boc-L-Pyroglutamate , 98% , 108963-96-8
Synonym(s):
(S )-Methyl-N-Boc-pyroglutamate;N-Boc-(S)-2-pyrrolidone-5-carboxylic acid methyl ester;N-Boc-5-oxo-L -proline methyl ester;Boc-L -pyroglutamic acid methyl ester;Boc-pGlu-OMe
CAS NO.：108963-96-8
Empirical Formula: C11H17NO5
Molecular Weight: 243.26
MDL number: MFCD06809720
EINECS: 600-890-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB30.40 | In Stock |
|
| 25G | RMB45.60 | In Stock |
|
| 100G | RMB141.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-72 °C
69-74 °C |
| Boiling point: | 361.6±35.0 °C(Predicted) |
| Density | 1.209±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in dichloromethane. |
| pka | -4.28±0.40(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]22/D 32.0°, c = 0.5 in chloroform &_& [α]22/D -32°, c = 0.5% in chloroform |
| InChI | InChI=1S/C11H17NO5/c1-11(2,3)17-10(15)12-7(9(14)16-4)5-6-8(12)13/h7H,5-6H2,1-4H3/t7-/m0/s1 |
| InChIKey | FNTAOUUEQHKLIU-ZETCQYMHSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C(=O)CC[C@H]1C(OC)=O |
| CAS DataBase Reference | 108963-96-8(CAS DataBase Reference) |
Description and Uses
Methyl (S)-1-Boc-5-oxopyrrolidine-2-carboxylate in medicine, pharmacy, cosmetics, and industrial, artificial flavoring and fragrance agents
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 36-43-50 |
| Safety Statements | 26-36/37-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29337900 |
