A1192212
1-Bromo-2,5-dimethoxybenzene , 98% , 25245-34-5
CAS NO.：25245-34-5
Empirical Formula: C8H9BrO2
Molecular Weight: 217.06
MDL number: MFCD00008355
EINECS: 246-756-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB39.20 | In Stock |
|
| 25G | RMB87.20 | In Stock |
|
| 50G | RMB159.20 | In Stock |
|
| 100G | RMB303.20 | In Stock |
|
| 250G | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 130-131 °C/10 mmHg (lit.) |
| Density | 1.445 g/mL at 25 °C (lit.) |
| refractive index | 1.569-1.571 |
| Flash point: | >110°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.445 |
| Water Solubility | Insoluble in water. |
| BRN | 2441884 |
| InChI | InChI=1S/C8H9BrO2/c1-10-6-3-4-8(11-2)7(9)5-6/h3-5H,1-2H3 |
| InChIKey | DWCGNRKFLRLWCJ-UHFFFAOYSA-N |
| SMILES | C1(OC)=CC=C(OC)C=C1Br |
| CAS DataBase Reference | 25245-34-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Bromo-2,5-dimethoxybenzene(25245-34-5) |
| EPA Substance Registry System | Benzene, 2-bromo-1,4-dimethoxy- (25245-34-5) |
Description and Uses
1-Bromo-2,5-dimethoxybenzene has been used in preparation of:
- S-(-)-2-[N-(trifluoroacetyl)amino]-1-(2,5-dimethoxy-4- bromophenyl)-1-propanone
- 1,4-bis{4-[2-(4-pyridyl)ethenyl]phenyl}butadiyne and 1,4-bis{2,5-dimethoxy-4-[2-(4-pyridyl)ethenyl]phenyl}butadiyne
- 1-bromo-4-iodo-2,5-dimethoxybenzene
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
