A3177712
Dimethoxydiphenylsilane , 98% , 6843-66-9
Synonym(s):
Diphenyldimethoxysilane
CAS NO.:6843-66-9
Empirical Formula: C14H16O2Si
Molecular Weight: 244.36
MDL number: MFCD00025690
EINECS: 229-929-1
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB25.60 | In Stock |
|
| 100ML | RMB66.40 | In Stock |
|
| 500ML | RMB218.40 | In Stock |
|
| 2.5L | RMB949.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 161 °C15 mm Hg(lit.) |
| Density | 1.08 g/mL at 20 °C(lit.) |
| vapor pressure | 0.03Pa at 25℃ |
| refractive index | n |
| Flash point: | 121°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| Specific Gravity | 1.0771 |
| color | colorless |
| Water Solubility | 3mg/L at 20℃ |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2940458 |
| InChI | 1S/C14H16O2Si/c1-15-17(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | AHUXYBVKTIBBJW-UHFFFAOYSA-N |
| SMILES | CO[Si](OC)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 6843-66-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Silane, dimethoxydiphenyl-(6843-66-9) |
| EPA Substance Registry System | Silane, dimethoxydiphenyl- (6843-66-9) |
Description and Uses
Reagent for preparation of diphenylsilylene derivatives of diols by exchange.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P280g-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 38 |
| Safety Statements | 28-37-24/25 |
| WGK Germany | 2 |
| RTECS | VV3643332 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Irrit. 2 |







