Dichlorodiphenylsilane , >97.0%(GC) , 80-10-4
Synonym(s):
Diphenyldichlorosilane
CAS NO.:80-10-4
Empirical Formula: C12H10Cl2Si
Molecular Weight: 253.2
MDL number: MFCD00000489
EINECS: 201-251-0
PRODUCT Properties
| Melting point: | -22 °C |
| Boiling point: | 305 °C(lit.) |
| Density | 1.204 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | 2 mm Hg ( 125 °C) |
| refractive index | n |
| Flash point: | 316 °F |
| storage temp. | Store below +30°C. |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | Liquid |
| Specific Gravity | 1.221 |
| color | Clear colorless to yellow |
| Water Solubility | DECOMPOSES |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 609882 |
| Stability: | Stable. Moisture sensitive. Flammable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12H10Cl2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | OSXYHAQZDCICNX-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(c1ccccc1)c2ccccc2 |
| LogP | 2 |
| CAS DataBase Reference | 80-10-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenyldichlorosilane(80-10-4) |
| EPA Substance Registry System | Benzene, 1,1'-(dichlorosilylene)bis- (80-10-4) |
Description and Uses
Diphenyl dichlorosilane is a colorless liquid. Ithas a sharp, pungent, HCl-like odor. Molecularweight= 253.21; Specific gravity = 1.22 at 25℃; Boilingpoint= 305℃; Autoignition temperature= 633.6℃; Flashpoint= 142℃ (oc). Hazard Identification (based on NFPA704 M Rating System): Health 3, Flammability 1,Reactivity 2 . Reacts with water; insoluble.
Dichlorodiphenylsilane is a silane based surface modifier, and a precursor which can be used in the synthesis of silica based materials. It is used to modify the surface by providing toughness, durability and resistance to shock. It can be used in the synthesis of a host material for the fabrication of blue phosphorescent organic light emitting diodes (OLEDs).
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H310-H314 |
| Precautionary statements | P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P361+P364 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,T |
| Risk Statements | 34-24-22 |
| Safety Statements | 26-36/37/39-45-28A |
| RIDADR | UN 1769 8/PG 2 |
| WGK Germany | 1 |
| RTECS | VV3190000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310095 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Skin Corr. 1B |
| Hazardous Substances Data | 80-10-4(Hazardous Substances Data) |
| Excepted Quantities | Not Permitted as Excepted Quantity |







