A3279312
Diethoxydiphenylsilane , 97% , 2553-19-7
CAS NO.：2553-19-7
Empirical Formula: C16H20O2Si
Molecular Weight: 272.41
MDL number: MFCD00015126
EINECS: 219-860-5
| Pack Size | Price | Stock | Quantity |
| 10g | RMB199.20 | In Stock |
|
| 25G | RMB237.60 | In Stock |
|
| 100G | RMB646.40 | In Stock |
|
| 250g | RMB2159.20 | In Stock |
|
| 500G | RMB2896.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 167 °C15 mm Hg(lit.) |
| Density | 1.033 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| form | liquid |
| Specific Gravity | 1.033 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 2281302 |
| InChI | InChI=1S/C16H20O2Si/c1-3-17-19(18-4-2,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | ZZNQQQWFKKTOSD-UHFFFAOYSA-N |
| SMILES | [Si](C1=CC=CC=C1)(C1=CC=CC=C1)(OCC)OCC |
| CAS DataBase Reference | 2553-19-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Silane, diethoxydiphenyl-(2553-19-7) |
| EPA Substance Registry System | Silane, diethoxydiphenyl- (2553-19-7) |
Description and Uses
Diphenyldiethoxysilane is a new diethoxydiphenylsilane based solid-phase microextraction fiber was developed to extract trace levels of polycyclic aromatic hydrocarbons in millk, human urine. Diethoxydiphenylsilane based coating can be used to detect explosives (2,4,5-trinitrotoulene, 2,4-dinitrotoluene, 2,4-dinitrotoluence) and explosive taggants (ethylene glycol dinitrate).This alkylsilylation reagent may be used for surface modification of nanoporous rice husk silica (RHS).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 29319090 |
