A1192612
2-Bromo-4-fluorophenol , 98% , 496-69-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB76.00 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 500g | RMB1060.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-45 °C (lit.) |
| Boiling point: | 89 °C/1 mmHg (lit.) |
| Density | 1.744 |
| refractive index | 1.554 |
| Flash point: | 185 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Solid |
| pka | 8.44±0.18(Predicted) |
| color | Light brown to brown |
| BRN | 2355593 |
| InChI | InChI=1S/C6H4BrFO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H |
| InChIKey | MEYRABVEYCFHHB-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C=C1Br |
| CAS DataBase Reference | 496-69-5(CAS DataBase Reference) |
Description and Uses
2-Bromo-4-fluorophenol was used in preparation of 4,4-difluoro-2-bromo-cyclohexadienone and 6-(aminomethylphenoxy)benzoxaborole analogs.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H302+H312+H332-H302-H315-H319-H335 |
| Precautionary statements | P210-P240-P241-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| PackingGroup | III |
| HS Code | 29071990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







