A1192912
Boc-D-Phe(3,4-Cl2)-OH , 98% , 114873-13-1
Synonym(s):
Boc-3,4-dichloro-D -phenylalanine
CAS NO.:114873-13-1
Empirical Formula: C14H17Cl2NO4
Molecular Weight: 334.2
MDL number: MFCD00151887
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB47.20 | In Stock |
|
| 250MG | RMB69.60 | In Stock |
|
| 1G | RMB167.20 | In Stock |
|
| 5G | RMB474.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120°C |
| alpha | -15 º (c=1,MeOH) |
| Boiling point: | 478.1±45.0 °C(Predicted) |
| Density | 1.3859 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.75±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 8428163 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H17Cl2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)7-8-4-5-9(15)10(16)6-8/h4-6,11H,7H2,1-3H3,(H,17,20)(H,18,19)/t11-/m1/s1 |
| InChIKey | UGZIQCCPEDCGGN-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(Cl)c(Cl)c1)C(O)=O |
| CAS DataBase Reference | 114873-13-1(CAS DataBase Reference) |
Description and Uses
N-Boc-D-3,4-dichlorophenylalanine is used to prepare fluorinated β-aminoacyl 1,2,4-triazolo[4,3-a]piperazine amides as dipeptidyl peptidase IV inhibitors and antidiabetic agents. It is also used in the synthesis of N-[(R,R)-(E)-1-(3,4-dichlorobenzyl)-3- (2-oxoazepan-3-yl)carbamoyl]allyl-N-methyl-3,5-bis(trifluoromethyl)benzamide as a potent and orally active dual neurokinin NK1/NK2 receptor antagonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






