A1194412
2-Bromobenzyl mercaptan , 99% , 143888-85-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB119.20 | In Stock |
|
| 1G | RMB244.80 | In Stock |
|
| 5G | RMB879.20 | In Stock |
|
| 25g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 256-257 °C (lit.) |
| Density | 1.527 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| form | clear liquid |
| pka | 9.15±0.10(Predicted) |
| color | Colorless to Almost colorless |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C7H7BrS/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5H2 |
| InChIKey | UJNSDLRPHRMVGZ-UHFFFAOYSA-N |
| SMILES | C1(CS)=CC=CC=C1Br |
| CAS DataBase Reference | 143888-85-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H331-H335-H301+H311+H331-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501-P304+P340-P305+P351+P338-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 23-24/25-36/37/38-20/21/22 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







