A1194912
Bis(4-chlorophenyl) disulfide , 98% , 1142-19-4
Synonym(s):
4,4′-Dichlorodiphenyl disulfide
CAS NO.:1142-19-4
Empirical Formula: C12H8Cl2S2
Molecular Weight: 287.23
MDL number: MFCD00013642
EINECS: 214-531-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB217.60 | In Stock |
|
| 100G | RMB726.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-74 °C(lit.) |
| Boiling point: | 180 °C / 2mmHg |
| Density | 1.304 g/cm3(Temp: 102.3 °C) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol |
| form | Solid |
| color | Light Yellow |
| BRN | 1644663 |
| InChI | InChI=1S/C12H8Cl2S2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H |
| InChIKey | ZIXXRXGPBFMPFD-UHFFFAOYSA-N |
| SMILES | S(C1=CC=C(Cl)C=C1)SC1=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 1142-19-4(CAS DataBase Reference) |
| EPA Substance Registry System | Disulfide, bis(4-chlorophenyl) (1142-19-4) |
Description and Uses
Bis(4-chlorophenyl) disulfide may be used to synthesize non-symmetrical heterodimer 4-chlorophenyl-2′-nitrophenyl disulfide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| RTECS | JO0766000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 1142-19-4(Hazardous Substances Data) |
| Toxicity | mouse,LD50,oral,> 3gm/kg (3000mg/kg),"Pesticide Index," Frear, E.H., ed., State College, PA, College Science Pub., 1969Vol. 4, Pg. 65, 1969. |






