A1195412
2-Bromothioanisole , 98% , 19614-16-5
Synonym(s):
2-Bromophenyl methyl sulfide
CAS NO.:19614-16-5
Empirical Formula: C7H7BrS
Molecular Weight: 203.1
MDL number: MFCD00000066
EINECS: 243-183-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB64.80 | In Stock |
|
| 25G | RMB277.60 | In Stock |
|
| 100G | RMB958.40 | In Stock |
|
| 500g | RMB4079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -24 °C (lit.) |
| Boiling point: | 145-146 °C/27 mmHg (lit.) |
| Density | 1.522 g/mL at 25 °C (lit.) |
| refractive index | 1.632-1.634 |
| Flash point: | >110°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.522 |
| BRN | 2243716 |
| InChI | InChI=1S/C7H7BrS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| InChIKey | ALAQDUSTXPEHMH-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC=C1SC |
| CAS DataBase Reference | 19614-16-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2-(methylthio)-(19614-16-5) |
Description and Uses
2-Bromothioanisole has been used in the preparation of:
- thioether-methyleneborane (PhSCH2B (C6F5)2)2
- 1-dimesitylboryl-2-methylthio-benzene
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, STENCH |
| HS Code | 29309090 |




![2,2-Bis[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]propane](https://img.chemicalbook.com/CAS/GIF/21850-44-2.gif)
