A1196112
1-Bromo-4-propylbenzene , 99% , 588-93-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB76.80 | In Stock |
|
| 100G | RMB128.00 | In Stock |
|
| 500G | RMB631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -41.4°C |
| Boiling point: | 225 °C(lit.) |
| Density | 1.286 g/mL at 25 °C(lit.) |
| vapor pressure | 4.7Pa at 25℃ |
| refractive index | n |
| Flash point: | 203 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.286 |
| color | Clear colorless to slightly yellow |
| Water Solubility | 2.867mg/L at 20℃ |
| InChI | InChI=1S/C9H11Br/c1-2-3-8-4-6-9(10)7-5-8/h4-7H,2-3H2,1H3 |
| InChIKey | NUPWGLKBGVNSJX-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(CCC)C=C1 |
| LogP | 4.9 at 25℃ |
| CAS DataBase Reference | 588-93-2(CAS DataBase Reference) |
Description and Uses
1-Bromo-4-propylbenzene is an aliphatic hydrocarbon compound containing a bromine functional group in its structure. This feature is crucial for its role in chemical reactions for synthesising other complex structures. 1-Bromo-4-propylbenzene can be used to prepare cyclopalladium catalysts.
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H318-H410 |
| Precautionary statements | P264-P273-P280-P302+P352-P305+P351+P338-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29036990 |






