A1198112
1-Bromo-4-isopropylbenzene , 98% , 586-61-8
Synonym(s):
4-Bromocumene
CAS NO.:586-61-8
Empirical Formula: C9H11Br
Molecular Weight: 199.09
MDL number: MFCD00039159
EINECS: 209-577-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB440.00 | In Stock |
|
| 100G | RMB1416.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -22 °C |
| Boiling point: | 103-104 °C(lit.) |
| Density | 1.286 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >100°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | Insoluble in water |
| BRN | 1858096 |
| InChI | InChI=1S/C9H11Br/c1-7(2)8-3-5-9(10)6-4-8/h3-7H,1-2H3 |
| InChIKey | MOZHUOIQYVYEPN-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C(C)C)C=C1 |
| CAS DataBase Reference | 586-61-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-4-(1-methylethyl)-(586-61-8) |
| EPA Substance Registry System | p-Bromocumene (586-61-8) |
Description and Uses
It employed as a intermediate for pharmaceutical.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H401-H302-H411 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313-P273 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-51/53 |
| Safety Statements | 60 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HazardClass | 9 |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |







