A1198812
4-Bromostyrene , 95%, containing 100-500ppmtbc stabilizers , 2039-82-9
Synonym(s):
p -Bromostyrene;1-(4-Bromophenyl)ethylene;1-Bromo-4-ethenylbenzene;1-Bromo-4-vinylbenzene;4-Vinyl-1-bromobenzene
CAS NO.:2039-82-9
Empirical Formula: C8H7Br
Molecular Weight: 183.05
MDL number: MFCD00000110
EINECS: 218-022-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB231.20 | In Stock |
|
| 100G | RMB771.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 4.5 °C |
| Boiling point: | 89 °C16 mm Hg(lit.) |
| Density | 1.40 g/mL at 20 °C |
| refractive index | n |
| Flash point: | 168 °F |
| storage temp. | -20°C |
| solubility | Miscible with ethanol, ether and benzene. |
| form | Liquid |
| color | light greenish-yellow |
| BRN | 1634204 |
| InChI | InChI=1S/C8H7Br/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2 |
| InChIKey | WGGLDBIZIQMEGH-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C=C)C=C1 |
| CAS DataBase Reference | 2039-82-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-BrC6H4CH=CH2(2039-82-9) |
Description and Uses
4-Bromostyrene is widely utilized in the synthesis of nitroolefins by alkene cross-metathesis. It plays an important role in the Heck reaction to the synthesis of poly(1,4-phenylenevinylene). It is employed in the structure activity relationships (SAR) study of the chemical and biochemical properties of the vinyl group of styrene. It is also used to investigate the photochemical growth of Br-terminated self-assembled monolayers. It is also involved in the synthesis of silsesquioxanes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 8 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 29036990 |





