A1199112
2-Bromostyrene , 97%, containing 0.1%to beopenphenol (TBC) stabilizer , 2039-88-5
Synonym(s):
o -Bromovinylbenzene;Styrene, o -bromo
CAS NO.:2039-88-5
Empirical Formula: C8H7Br
Molecular Weight: 183.05
MDL number: MFCD00000076
EINECS: 218-027-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.80 | In Stock |
|
| 5G | RMB235.20 | In Stock |
|
| 25G | RMB938.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7°C |
| Boiling point: | 102-104 °C/22 mmHg (lit.) |
| Density | 1.46 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 186 °F |
| storage temp. | 2-8°C |
| solubility | Miscible with methanol. |
| form | clear liquid |
| Specific Gravity | 1.4160 |
| color | Colorless to Yellow |
| BRN | 2323537 |
| InChI | InChI=1S/C8H7Br/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2 |
| InChIKey | SSZOCHFYWWVSAI-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC=C1C=C |
| CAS DataBase Reference | 2039-88-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2-ethenyl-(2039-88-5) |
Description and Uses
2-Bromostyrene is used as a cross linking agent in fire-resistant bromostyrene-crosslinked polyesters. Further, it is used to prepare trans-1-(2-bromophenyl)-2-(3-bromophenyl)ethene by reacting with 1-bromo-3-iodo-benzene, involving palladium(II) acetate as catalyst.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29036990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




