4-Bromo-2,6-difluorobenzoic acid , 98% , 183065-68-1
CAS NO.：183065-68-1
Empirical Formula: C7H3BrF2O2
Molecular Weight: 237
MDL number: MFCD03094085
EINECS: 457-940-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB199.20 | In Stock |
|
| 100G | RMB719.20 | In Stock |
|
| 500g | RMB3279.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 201-203°C |
| Boiling point: | 271.7±40.0 °C(Predicted) |
| Density | 1.872±0.06 g/cm3(Predicted) |
| vapor pressure | 0-1.1Pa at 25-78℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.11±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H3BrF2O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12) |
| InChIKey | IRHPJGPQWZEZRX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C=C(Br)C=C1F |
| LogP | 2.5 at 25℃ |
| CAS DataBase Reference | 183065-68-1(CAS DataBase Reference) |
Description and Uses
4-Bromo-2,6-difluorobenzoic acid (4-Br-2,6-DFA) is an organic compound that holds significant prominence in scientific research. It serves as a crucial intermediate in the synthesis of various organic compounds and finds frequent utilization in laboratory experiments.
In the realm of scientific research, 4-Bromo-2,6-difluorobenzoic acid enjoys wide-ranging usage. It serves as a pivotal intermediate in synthesizing an array of organic compounds. Moreover, its application extends to the synthesis of compounds such as insecticides and herbicides. Additionally, 4-Bromo-2,6-difluorobenzoic acid plays a crucial role in studying enzyme kinetics and has been instrumental in synthesizing diverse peptides and proteins. Although the complete mechanism of action of 4-Bromo-2,6-difluorobenzoic acid remains elusive, it is believed to function as a competitive inhibitor of enzymes like cytochrome P450, along with other enzymes involved in the metabolism of organic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H302-H319-H335 |
| Precautionary statements | P305+P351+P338-P261-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163100 |
