A1201312
3,5-Bis(trifluoromethyl)aniline , 98% , 328-74-5
Synonym(s):
α,α,α,α′,α′,α′-Hexafluoro-3,5-xylidine;5-Amino-α,α,α,α′,α′,α′-hexafluoro-m-xylene
CAS NO.:328-74-5
Empirical Formula: C8H5F6N
Molecular Weight: 229.12
MDL number: MFCD00000394
EINECS: 206-335-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB47.20 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 50G | RMB127.20 | In Stock |
|
| 100G | RMB237.60 | In Stock |
|
| 500g | RMB993.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168.2-169.2 °C |
| Boiling point: | 85 °C15 mm Hg(lit.) |
| Density | 1.467 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 182 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.15±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.473 |
| color | Clear light yellow to yellow-brown |
| Water Solubility | Not miscible in water. |
| BRN | 654318 |
| InChI | 1S/C8H5F6N/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-3H,15H2 |
| InChIKey | CDIDGWDGQGVCIB-UHFFFAOYSA-N |
| SMILES | Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 328-74-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 3,5-bis(trifluoromethyl)-(328-74-5) |
| EPA Substance Registry System | Benzenamine, 3,5-bis(trifluoromethyl)- (328-74-5) |
Description and Uses
3,5-Bis(trifluoromethyl)aniline was found to be a highly efficient monodentate transient directing group (MonoTDG) for the palladium-catalyzed direct dehydrogenative cross-coupling of benzaldehydes with arenes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 33-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | ZE9800000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214910 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






