A1203012
(S)-(-)-N-Benzyl-α-methylbenzylamine , 99% , 17480-69-2
Synonym(s):
(S)-(−)-N-(1-Phenylethyl)benzylamine;(S)-(−)-N-Benzyl-α-phenylethylamine
CAS NO.:17480-69-2
Empirical Formula: C15H17N
Molecular Weight: 211.3
MDL number: MFCD00066325
EINECS: 605-736-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100G | RMB317.60 | In Stock |
|
| 500G | RMB1597.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -39 º (neat) |
| Boiling point: | 171 °C15 mm Hg(lit.) |
| Density | 1.01 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 8.79±0.19(Predicted) |
| Specific Gravity | 1.01 |
| color | Clear colorless to yellow |
| optical activity | [α]19/D 40°, neat |
| Sensitive | Air Sensitive |
| BRN | 3650264 |
| InChI | 1S/C15H17N/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3/t13-/m0/s1 |
| InChIKey | ZYZHMSJNPCYUTB-ZDUSSCGKSA-N |
| SMILES | C[C@H](NCc1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 17480-69-2(CAS DataBase Reference) |
| NIST Chemistry Reference | (R)-(+)-n-benzyl-«alpha»-methylbenzylamine(17480-69-2) |
Description and Uses
(S)-()-N-Benzyl-α-methylbenzylamine can be used:
- In one of the key synthetic steps for the preparation of a cardioprotective drug named CP-060S.
- To prepare (1S,2S,3S,5R)-tert-butyl 3-[benzyl((S)-1-phenylethyl)amino]-6,6-dimethylbicyclo[3.1.1]heptane-2-carboxylate, an intermediate used to synthesize pinane-based β- and γ-amino acids.
- To prepare urea derivatives as potent antimicrobial agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





