A1203250
Disuccinimidylglutarate , 98% , 79642-50-5
Synonym(s):
CDHF4;desmoglein 1;DG1;DSG
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB79.20 | In Stock |
|
| 250mg | RMB263.20 | In Stock |
|
| 1g | RMB939.20 | In Stock |
|
| 5g | RMB3499.20 | In Stock |
|
| 10g | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-172 °C |
| Boiling point: | 485.1±55.0 °C(Predicted) |
| Density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in dimethylsulfoxide and dimethylformamide. |
| form | Solid |
| color | White to Off-White |
| Appearance | White solid |
| Water Solubility | Partially soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 8575145 |
| Stability: | Hygroscopic, Moisture Sensitive, Unstable in Aqueous Solution |
| InChI | InChI=1S/C13H14N2O8/c16-8-4-5-9(17)14(8)22-12(20)2-1-3-13(21)23-15-10(18)6-7-11(15)19/h1-7H2 |
| InChIKey | LNQHREYHFRFJAU-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CCCC(ON1C(=O)CCC1=O)=O |
| CAS DataBase Reference | 79642-50-5 |
Description and Uses
Disuccinimidyl glutarate (DSG) is a homobifunctional crosslinking agent that contains amine-reactive N-hydroxysuccinimide (NHS) ester groups at each end. DSG is membrane-permeable and non-cleavable. DSG can be combined with formaldehyde fixation to improve the detection of specific protein-DNA complexes.
Disuccinimidyl glutarate is used as a membrane-soluble, amine-reactive N-hydroxysuccinamide ester-based homobifunctional crosslinking reagent. It is a homobifunctionla cross-linking reagent, for ex. isolation of the insulin receptor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





