A3581012
Di(<i>N</i>-succinimidyl) Suberate , ≥98.0% , 68528-80-3
Synonym(s):
Disuccinimidyl octanedioate;Disuccinimidyl suberate;Disuccinimidyl suberate (DSS)
CAS NO.:68528-80-3
Empirical Formula: C16H20N2O8
Molecular Weight: 368.34
MDL number: MFCD00049059
EINECS: 614-576-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB60.32 | In Stock |
|
| 500mg | RMB71.20 | In Stock |
|
| 1G | RMB124.80 | In Stock |
|
| 5G | RMB428.80 | In Stock |
|
| 25g | RMB1582.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-170°C |
| Boiling point: | 513.5±60.0 °C(Predicted) |
| Density | 1.295 g/cm3 |
| storage temp. | 2-8°C |
| solubility | chloroform: 50 mg/mL |
| form | powder |
| color | White to Almost white |
| Appearance | White solid |
| Water Solubility | Insoluble in water. Soluble in chloroform: 50 mg/mL. |
| InChI | InChI=1S/C16H20N2O8/c19-11-7-8-12(20)17(11)25-15(23)5-3-1-2-4-6-16(24)26-18-13(21)9-10-14(18)22/h1-10H2 |
| InChIKey | ZWIBGKZDAWNIFC-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CCCCCCC(ON1C(=O)CCC1=O)=O |
| CAS DataBase Reference | 68528-80-3 |
Description and Uses
DSS Crosslinker is a membrane permeable, noncleavable crosslinker. The NHS ester groups are reactive toward primary amines.
Disuccinimidyl suberate is a homobifunctional amine-reactive crosslinker. It is usually coupled to molecules containing primary amines via amide bonds buffered at pH 7.5 (6.5-8.5). It incorporates an 8-atom spacer arm.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29171900 |






