A1203312
Bis(4-bromophenyl) ether , 99% , 2050-47-7
Synonym(s):
4,4′-DiBDE;4,4′-Dibromodiphenyl ether solution;4-Bromophenyl ether;PBDE 15
CAS NO.:2050-47-7
Empirical Formula: C12H8Br2O
Molecular Weight: 328
MDL number: MFCD00000095
EINECS: 218-090-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB153.60 | In Stock |
|
| 500g | RMB756.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-63 °C(lit.) |
| Boiling point: | 338-340 °C(lit.) |
| Density | 1.6728 (rough estimate) |
| refractive index | 1.6260 (estimate) |
| Flash point: | 338-340°C |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly) |
| form | Crystalline |
| color | White |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C12H8Br2O/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H |
| InChIKey | YAWIAFUBXXPJMQ-UHFFFAOYSA-N |
| SMILES | O(C1=CC=C(Br)C=C1)C1=CC=C(Br)C=C1 |
| CAS DataBase Reference | 2050-47-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromophenyl ether(2050-47-7) |
| EPA Substance Registry System | p,p'-Dibromodiphenyl ether (2050-47-7) |
Description and Uses
PBDE 15 is a polybrominated di-Ph ether (PBDE), which is a flame retardant often incorporated into many polymers. PBDEs are an environmental pollutant that exhibit potential health risks to humans and wildlife.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H410 |
| Precautionary statements | P210-P261-P273-P301+P310-P331-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,Xn,N |
| Risk Statements | 33-67-65-50/53-38-11 |
| Safety Statements | 24/25-62-61-60-33-29-16-9 |
| RIDADR | UN 1262 3/PG 2 |
| WGK Germany | 3 |
| RTECS | KN0175000 |
| TSCA | Yes |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 ipr-mus: 125 mg/kg NTIS** AD277-689 |






